Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3323 | Purity: >98% |
 | |
| Chemical structure of Tetrakis(4-aminophenyl)methane |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | 4,4',4'',4'''-Methanetetrayltetraaniline |
|---|---|
| CAS No. | 60532-63-0 |
| Purity | >98% |
| Formula | C25H24N4 |
| Mol Weight | 380.4849 |
| CoA | CoA of Tetrakis(4-aminophenyl)methane |
| Smiles: | C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C3=CC=C(C=C3)N)C4=CC=C(C=C4)N)N |
|---|
KEYWORDS: buy Tetrakis(4-aminophenyl)methane | Tetrakis(4-aminophenyl)methane supplier | purchase | cost | manufacturer | order | distributor | buy 60532-63-0 | 60532-63-0 supplier