Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A146 | Purity: >98% |
 | |
| Chemical structure of Tenovin-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 380315-80-0 |
|---|---|
| Purity | >98% |
| Formula | C20H23N3O2S |
| Mol Weight | 369.481 |
| CoA | CoA of Tenovin-1 |
| Smiles: | CC(=O)NC1=CC=C(NC(=S)NC(=O)C2=CC=C(C=C2)C(C)(C)C)C=C1 |
|---|
KEYWORDS: buy Tenovin-1 | Tenovin-1 supplier | purchase | cost | manufacturer | order | distributor | buy 380315-80-0 | 380315-80-0 supplier