Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3986 | Purity: >98% |
 | |
| Chemical structure of Tenonitrozole |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3810-35-3 |
|---|---|
| Purity | >98% |
| Formula | C8H5N3O3S2 |
| Mol Weight | 255.274 |
| CoA | CoA of Tenonitrozole |
| Smiles: | C1=CSC(=C1)C(=O)NC2=NC=C(S2)[N+](=O)[O-] |
|---|
KEYWORDS: buy Tenonitrozole | Tenonitrozole supplier | purchase | cost | manufacturer | order | distributor | buy 3810-35-3 | 3810-35-3 supplier