Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1619 | Purity: >98% |
 | |
| Chemical structure of Telotristat etiprate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | LX1606 Hippurate |
|---|---|
| CAS No. | 1137608-69-5 |
| Purity | >98% |
| Formula | C36H35ClF3N7O6 |
| Mol Weight | 754.155 |
| CoA | CoA of Telotristat etiprate |
| Smiles: | OC(=O)CNC(=O)C1=CC=CC=C1.CCOC(=O)[C@@H](N)CC1=CC=C(C=C1)C1=CC(O[C@H](C2=C(C=C(Cl)C=C2)N2C=CC(C)=N2)C(F)(F)F)=NC(N)=N1 |
|---|
KEYWORDS: buy Telotristat etiprate | Telotristat etiprate supplier | purchase | cost | manufacturer | order | distributor | buy 1137608-69-5 | 1137608-69-5 supplier