Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1377 | Purity: >98% |
 | |
| Chemical structure of Tazobactam acid |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 89786-04-9 |
|---|---|
| Purity | >98% |
| Formula | C10H12N4O5S |
| Mol Weight | 300.291 |
| CoA | CoA of Tazobactam acid |
| Smiles: | [H][C@@]12CC(=O)N1[C@@H](C(O)=O)[C@](C)(CN1C=CN=N1)S2(=O)=O |
|---|
KEYWORDS: buy Tazobactam acid | Tazobactam acid supplier | purchase | cost | manufacturer | order | distributor | buy 89786-04-9 | 89786-04-9 supplier