Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1755 | Purity: >98% |
 | |
| Chemical structure of TAS-102 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 733030-01-8 |
|---|---|
| Purity | >98% |
| Formula | C19H23Cl2F3N6O7 |
| Mol Weight | 575.323 |
| CoA | CoA of TAS-102 |
| Smiles: | Cl[H].ClC1=C(CN2CCCC2=N)NC(=O)NC1=O.OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(C(=O)NC1=O)C(F)(F)F |
|---|
KEYWORDS: buy TAS-102 | TAS-102 supplier | purchase | cost | manufacturer | order | distributor | buy 733030-01-8 | 733030-01-8 supplier