Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1861 | Purity: >98% |
 | |
| Chemical structure of Takeda-6d |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1125632-93-0 |
|---|---|
| Purity | >98% |
| Formula | C27H19ClFN5O3S |
| Mol Weight | 547.988 |
| CoA | CoA of Takeda-6d |
| Smiles: | FC1=CC=C(OC2=CC=C3N=C(NC(=O)C4CC4)SC3=N2)C=C1NC(=O)C1=CC=CC(=C1Cl)C1(CC1)C#N |
|---|
KEYWORDS: buy Takeda-6d | Takeda-6d supplier | purchase | cost | manufacturer | order | distributor | buy 1125632-93-0 | 1125632-93-0 supplier