Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1568 | Purity: >98% |
 | |
| Chemical structure of TAK-960 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1137868-96-2 |
|---|---|
| Purity | >98% |
| Formula | C27H35ClF3N7O3 |
| Mol Weight | 598.06 |
| CoA | CoA of TAK-960 hydrochloride |
| Smiles: | Cl.COC1=CC(C(=O)NC2CCN(C)CC2)=C(F)C=C1NC1=NC2=C(C=N1)N(C)C(=O)C(F)(F)CN2C1CCCC1 |
|---|
KEYWORDS: buy TAK-960 hydrochloride | TAK-960 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1137868-96-2 | 1137868-96-2 supplier