Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A568 | Purity: >98% |
 | |
| Chemical structure of TAK-063 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Balipodect |
|---|---|
| CAS No. | 1238697-26-1 |
| Purity | >98% |
| Formula | C23H17FN6O2 |
| Mol Weight | 428.4185 |
| CoA | CoA of TAK-063 |
| Smiles: | COC1=CN(N=C(C2=CC=NN2C2=CC=CC=C2)C1=O)C1=CC=C(C=C1F)N1C=CC=N1 |
|---|
KEYWORDS: buy TAK-063 | TAK-063 supplier | purchase | cost | manufacturer | order | distributor | buy 1238697-26-1 | 1238697-26-1 supplier