Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A564 | Purity: >98% |
 | |
| Chemical structure of Tafluprost |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 209860-87-7 |
|---|---|
| Purity | >98% |
| Formula | C25H34F2O5 |
| Mol Weight | 452.5313 |
| CoA | CoA of Tafluprost |
| Smiles: | CC(C)OC(=O)CCC\C=C/C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\C(F)(F)COC1=CC=CC=C1 |
|---|
KEYWORDS: buy Tafluprost | Tafluprost supplier | purchase | cost | manufacturer | order | distributor | buy 209860-87-7 | 209860-87-7 supplier