Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A128 | Purity: >98% |
 | |
| Chemical structure of TAC-101 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 125973-56-0 |
|---|---|
| Purity | >98% |
| Formula | C20H27NO3Si2 |
| Mol Weight | 385.6043 |
| CoA | CoA of TAC-101 |
| Smiles: | C[Si](C)(C)C1=CC(=CC(=C1)C(=O)NC1=CC=C(C=C1)C(O)=O)[Si](C)(C)C |
|---|
KEYWORDS: buy TAC-101 | TAC-101 supplier | purchase | cost | manufacturer | order | distributor | buy 125973-56-0 | 125973-56-0 supplier