Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3490 | Purity: >98% |
 | |
| Chemical structure of T 3364366 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | T-3364366 |
|---|---|
| CAS No. | 1356354-09-0 |
| Purity | >98% |
| Formula | C18H16F3N3O3S2 |
| Mol Weight | 443.463 |
| CoA | CoA of T 3364366 |
| Smiles: | CC(=O)NCCSC1=NC2=CSC=C2C(=O)N1C3=CC=C(C=C3)OCC(F)(F)F |
|---|
KEYWORDS: buy T 3364366 | T 3364366 supplier | purchase | cost | manufacturer | order | distributor | buy 1356354-09-0 | 1356354-09-0 supplier