Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3743 | Purity: >98% |
 | |
| Chemical structure of SYN-AK |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 823202-99-9 |
|---|---|
| Purity | >98% |
| Formula | C23H37N5O7 |
| Mol Weight | 495.5692 |
| CoA | CoA of SYN-AK |
| Smiles: | CC(=O)O.CC(=O)O.C1C[C@H](N(C1)C(=O)CCN)C(=O)N[C@@H](CCN)C(=O)NCC2=CC=CC=C2 |
|---|
KEYWORDS: buy SYN-AK | SYN-AK supplier | purchase | cost | manufacturer | order | distributor | buy 823202-99-9 | 823202-99-9 supplier