Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A553 | Purity: >98% |
 | |
| Chemical structure of Sunitinib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | SU-11248 |
|---|---|
| Synonyms 2 | Related CAS: 342641-94-5 |
| CAS No. | 557795-19-4 |
| Purity | >98% |
| Formula | C22H27FN4O2 |
| Mol Weight | 398.4738 |
| CoA | CoA of Sunitinib |
| Smiles: | CCN(CC)CCNC(=O)C1=C(C)NC(\C=C2/C(=O)NC3=C2C=C(F)C=C3)=C1C |
|---|
KEYWORDS: buy Sunitinib | Sunitinib supplier | purchase | cost | manufacturer | order | distributor | buy 557795-19-4 | 557795-19-4 supplier