Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2000 | Purity: >98% |
 | |
| Chemical structure of Sulbactam |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Sulbactam Acid |
|---|---|
| CAS No. | 68373-14-8 |
| Purity | >98% |
| Formula | C8H11NO5S |
| Mol Weight | 233.242 |
| CoA | CoA of Sulbactam |
| Smiles: | [H][C@@]12CC(=O)N1[C@@H](C(O)=O)C(C)(C)S2(=O)=O |
|---|
KEYWORDS: buy Sulbactam | Sulbactam supplier | purchase | cost | manufacturer | order | distributor | buy 68373-14-8 | 68373-14-8 supplier