Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3720 | Purity: >98% |
 | |
| Chemical structure of ST3932 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1246018-21-2 |
|---|---|
| Purity | >98% |
| Formula | C12H16N8O |
| Mol Weight | 288.3084 |
| CoA | CoA of ST3932 |
| Smiles: | OC(C)CCC1=NC(N(C)C(N2N=CC=N2)=N3)=C3C(N)=N1 |
|---|
KEYWORDS: buy ST3932 | ST3932 supplier | purchase | cost | manufacturer | order | distributor | buy 1246018-21-2 | 1246018-21-2 supplier