Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1174 | Purity: >98% |
 | |
| Chemical structure of SRT3025 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1231952-55-8 |
|---|---|
| Purity | >98% |
| Formula | C31H31N5O2S2 |
| Mol Weight | 569.74 |
| CoA | CoA of SRT3025 hydrochloride |
| Smiles: | COCCCC1=C(N=C(S1)C1=CC=CC=C1)C(=O)NC1=CC=CC=C1C1=NC2=CC(CN3CCCC3)=CN=C2S1 |
|---|
KEYWORDS: buy SRT3025 hydrochloride | SRT3025 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1231952-55-8 | 1231952-55-8 supplier