Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A033 | Purity: >98% |
 | |
| Chemical structure of SRT1720 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1001645-58-4 |
|---|---|
| Purity | >98% |
| Formula | C25H23N7OS |
| Mol Weight | 469.561 |
| CoA | CoA of SRT1720 |
| Smiles: | O=C(NC1=CC=CC=C1C1=CN2C(CN3CCNCC3)=CSC2=N1)C1=NC2=CC=CC=C2N=C1 |
|---|
KEYWORDS: buy SRT1720 | SRT1720 supplier | purchase | cost | manufacturer | order | distributor | buy 1001645-58-4 | 1001645-58-4 supplier