Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3008-1 | Purity: >98% |
 | |
| Chemical structure of SRI-011381 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2070014-88-7 |
|---|---|
| Purity | >98% |
| Formula | C20H32ClN3O |
| Mol Weight | 365.941 |
| CoA | CoA of SRI-011381 hydrochloride |
| Smiles: | Cl[H].O=C(NC1CCCCC1)N(CC1CCNCC1)CC1=CC=CC=C1 |
|---|
KEYWORDS: buy SRI-011381 hydrochloride | SRI-011381 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 2070014-88-7 | 2070014-88-7 supplier