Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A726 | Purity: >98% |
 | |
| Chemical structure of SR9009 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1379686-30-2 |
|---|---|
| Purity | >98% |
| Formula | C20H24ClN3O4S |
| Mol Weight | 437.94 |
| CoA | CoA of SR9009 |
| Smiles: | CCOC(=O)N1CCC(CN(CC2=CC=C(S2)[N+]([O-])=O)CC2=CC=C(Cl)C=C2)C1 |
|---|
KEYWORDS: buy SR9009 | SR9009 supplier | purchase | cost | manufacturer | order | distributor | buy 1379686-30-2 | 1379686-30-2 supplier