Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17349 | Purity: >98% |
 | |
| Chemical structure of SPH7854 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2796195-48-5 |
|---|---|
| Purity | >98% |
| Formula | C24H25N3O4S |
| Mol Weight | 451.538 |
| CoA | CoA of SPH7854 |
| Smiles: | O=C(NC1=CN=C(C=C1)C(=O)C(C2=NC=CC=C2)(C)C)CC3=CC=C(C=C3)S(=O)(=O)CC |
|---|
KEYWORDS: buy SPH7854 | SPH7854 supplier | purchase | cost | manufacturer | order | distributor | buy 2796195-48-5 | 2796195-48-5 supplier