Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1998 | Purity: 98.51% |
 | |
| Chemical structure of SP600125 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 129-56-6 |
|---|---|
| Purity | 98.51% |
| Formula | C14H8N2O |
| Mol Weight | 220.2261 |
| CoA | CoA of SP600125 |
| Smiles: | O=C1C2=C3C(NN=C3C3=C1C=CC=C3)=CC=C2 |
|---|
KEYWORDS: buy SP600125 | SP600125 supplier | purchase | cost | manufacturer | order | distributor | buy 129-56-6 | 129-56-6 supplier