Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15353 | Purity: >98% |
 | |
| Chemical structure of Solriamfetol hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 178429-65-7 |
|---|---|
| Purity | >98% |
| Formula | C10H15ClN2O2 |
| Mol Weight | 230.691 |
| CoA | CoA of Solriamfetol hydrochloride |
| Smiles: | C1=CC=C(C=C1)C[C@H](COC(=O)N)N.Cl |
|---|
KEYWORDS: buy Solriamfetol hydrochloride | Solriamfetol hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 178429-65-7 | 178429-65-7 supplier