Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11585 | Purity: >98% |
 | |
| Chemical structure of SM1-3 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2550577-41-6 |
|---|---|
| Purity | >98% |
| Formula | C15H15N |
| Mol Weight | 209.2863 |
| CoA | CoA of SM1-3 |
| Smiles: | C=1C=CC=2C(C1)=CC=C3NC(=C(C32)C)CC |
|---|
KEYWORDS: buy SM1-3 | SM1-3 supplier | purchase | cost | manufacturer | order | distributor | buy 2550577-41-6 | 2550577-41-6 supplier