Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1482 | Purity: >98% |
 | |
| Chemical structure of SGX-523 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1022150-57-7 |
|---|---|
| Purity | >98% |
| Formula | C18H13N7S |
| Mol Weight | 359.408 |
| CoA | CoA of SGX-523 |
| Smiles: | CN1C=C(C=N1)C1=NN2C(SC3=CC4=C(C=C3)N=CC=C4)=NN=C2C=C1 |
|---|
KEYWORDS: buy SGX-523 | SGX-523 supplier | purchase | cost | manufacturer | order | distributor | buy 1022150-57-7 | 1022150-57-7 supplier