Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1451 | Purity: >98% |
 | |
| Chemical structure of SGC2085 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1821908-48-8 |
|---|---|
| Purity | >98% |
| Formula | C19H24N2O2 |
| Mol Weight | 312.4061 |
| CoA | CoA of SGC2085 |
| Smiles: | C[C@H](N)C(=O)NCC1=CC(C)=C(OC2=CC(C)=CC(C)=C2)C=C1 |
|---|
KEYWORDS: buy SGC2085 | SGC2085 supplier | purchase | cost | manufacturer | order | distributor | buy 1821908-48-8 | 1821908-48-8 supplier