Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2977 | Purity: >98% |
 | |
| Chemical structure of SGC-GAK-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2226517-76-4 |
|---|---|
| Purity | >98% |
| Formula | C18H17BrN2O3 |
| Mol Weight | 389.243 |
| CoA | CoA of SGC-GAK-1 |
| Smiles: | COC1=CC(NC2=CC=NC3=CC=C(Br)C=C23)=CC(OC)=C1OC |
|---|
KEYWORDS: buy SGC-GAK-1 | SGC-GAK-1 supplier | purchase | cost | manufacturer | order | distributor | buy 2226517-76-4 | 2226517-76-4 supplier