Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1141-1 | Purity: >98% |
 | |
| Chemical structure of SEP-0372814 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | PDE10-IN-1 (1516895-53-6) |
|---|---|
| CAS No. | 1516896-09-5 |
| Purity | >98% |
| Formula | C21H19N7 |
| Mol Weight | 369.4225 |
| CoA | CoA of SEP-0372814 |
| Smiles: | CC1=C(N=C2N1C=CC1=C2C=CC=N1)[C@@H]1C[C@H]1C1=NN2C(=N1)C(C)=NC=C2C |
|---|
KEYWORDS: buy SEP-0372814 | SEP-0372814 supplier | purchase | cost | manufacturer | order | distributor | buy 1516896-09-5 | 1516896-09-5 supplier