Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1618 | Purity: >98% |
 | |
| Chemical structure of Selonsertib hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | GS-4997 hydrochloride |
|---|---|
| CAS No. | 1448428-05-4 |
| Purity | >98% |
| Formula | C24H25ClFN7O |
| Mol Weight | 481.953 |
| CoA | CoA of Selonsertib hydrochloride |
| Smiles: | Cl.CC(C)N1C=NN=C1C1=CC=CC(NC(=O)C2=CC(N3C=NC(=C3)C3CC3)=C(C)C=C2F)=N1 |
|---|
KEYWORDS: buy Selonsertib hydrochloride | Selonsertib hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1448428-05-4 | 1448428-05-4 supplier