Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2929 | Purity: >98% |
 | |
| Chemical structure of SEL120-34A |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1609522-33-9 |
|---|---|
| Purity | >98% |
| Formula | C15H18Br2N4 |
| Mol Weight | 414.138 |
| CoA | CoA of SEL120-34A |
| Smiles: | CC1=C(Br)C(Br)=C2CCCN3C(=NC1=C23)N1CCNCC1 |
|---|
KEYWORDS: buy SEL120-34A | SEL120-34A supplier | purchase | cost | manufacturer | order | distributor | buy 1609522-33-9 | 1609522-33-9 supplier