Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1854 | Purity: >98% |
 | |
| Chemical structure of Nidufexor |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1773489-72-7 |
|---|---|
| Purity | >98% |
| Formula | C27H22ClN3O4 |
| Mol Weight | 487.934 |
| Appearance | off-white solid powder |
| Solubility | DMSO >50mg/mL; Insoluble in water |
| Shelf Life | >2 years if stored properly |
| Storage | Powder -20℃ 2 years; In solvent -20℃ 1 month; |
| Reference: | [1]. Proposed INN: List 118. WHO Drug Information, Vol. 31, No. 4, 2017. |
| CoA | CoA of Nidufexor |
| Smiles: | CN1N=C(C(=O)N(CC2=CC=CC=C2)CC2=CC=C(C=C2)C(O)=O)C2=C1C1=C(OC2)C=CC(Cl)=C1 |
|---|
KEYWORDS: buy Nidufexor | Nidufexor supplier | purchase | cost | manufacturer | order | distributor | buy 1773489-72-7 | 1773489-72-7 supplier