Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2213 | Purity: >98% |
 | |
| Chemical structure of LY2584702 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1082949-67-4 |
|---|---|
| Purity | >98% |
| Formula | C21H19F4N7 |
| Mol Weight | 445.4161 |
| CoA | CoA of LY2584702 |
| Smiles: | CN1C=C(N=C1C1CCN(CC1)C1=C2C=NNC2=NC=N1)C1=CC=C(F)C(=C1)C(F)(F)F |
|---|
KEYWORDS: buy LY2584702 | LY2584702 supplier | purchase | cost | manufacturer | order | distributor | buy 1082949-67-4 | 1082949-67-4 supplier