Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16936 | Purity: >98% |
 | |
| Chemical structure of SD-2301 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3054116-24-1 |
|---|---|
| Purity | >98% |
| Formula | C64H80N13O15PS2 |
| Mol Weight | 1366.502 |
| CoA | CoA of SD-2301 |
| Smiles: | C(N[C@H](C(NCC1=CC=C(S(CC)(=O)=O)C=C1)=O)CCC(N)=O)(=O)[C@H]2N3[C@](CC2)(CCN(C(CCCCC4=CN([C@H](C(=O)N5[C@H](C(N[C@@H](C)C6=CC=C(C=C6)C=7SC=NC7C)=O)C[C@@H](O)C5)C(C)(C)C)N=N4)=O)C[C@H](NC(=O)C8=CC=9C(N8)=CC=C(C(P(=O)(O)O)=O)C9)C3=O)[H] |
|---|
KEYWORDS: buy SD-2301 | SD-2301 supplier | purchase | cost | manufacturer | order | distributor | buy 3054116-24-1 | 3054116-24-1 supplier