Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1108 | Purity: >98% |
 | |
| Chemical structure of Scriptaid |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 287383-59-9 |
|---|---|
| Purity | >98% |
| Formula | C18H18N2O4 |
| Mol Weight | 326.3465 |
| CoA | CoA of Scriptaid |
| Smiles: | ONC(=O)CCCCCN1C(=O)C2=CC=CC3=CC=CC(C1=O)=C23 |
|---|
KEYWORDS: buy Scriptaid | Scriptaid supplier | purchase | cost | manufacturer | order | distributor | buy 287383-59-9 | 287383-59-9 supplier