Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17177 | Purity: >98% |
 | |
| Chemical structure of SCR-1479 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1174047-03-0 |
|---|---|
| Purity | >98% |
| Formula | C36H23ClF2N4O3 |
| Mol Weight | 633.043 |
| CoA | CoA of SCR-1479 |
| Smiles: | O=C(NC1=CC=C(OC=2C=CN=C(N=C(C=3C=CC=CC3)C=4C=CC=CC4)C2Cl)C(F)=C1)C5=CNC=C(C5=O)C=6C=CC(F)=CC6 |
|---|
KEYWORDS: buy SCR-1479 | SCR-1479 supplier | purchase | cost | manufacturer | order | distributor | buy 1174047-03-0 | 1174047-03-0 supplier