Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2102 | Purity: >98% |
 | |
| Chemical structure of SCH900776 S-isomer |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | MK-8776 S-isomer |
|---|---|
| CAS No. | 891494-64-7 |
| Purity | >98% |
| Formula | C15H18BrN7 |
| Mol Weight | 376.254 |
| CoA | CoA of SCH900776 S-isomer |
| Smiles: | CN1C=C(C=N1)C1=C2N=C([C@H]3CCCNC3)C(Br)=C(N)N2N=C1 |
|---|
KEYWORDS: buy SCH900776 S-isomer | SCH900776 S-isomer supplier | purchase | cost | manufacturer | order | distributor | buy 891494-64-7 | 891494-64-7 supplier