Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1464 | Purity: >98% |
 | |
| Chemical structure of SCH58261 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 160098-96-4 |
|---|---|
| Purity | >98% |
| Formula | C18H15N7O |
| Mol Weight | 345.358 |
| CoA | CoA of SCH58261 |
| Smiles: | NC1=NC2=C(C=NN2CCC2=CC=CC=C2)C2=NC(=NN12)C1=CC=CO1 |
|---|
KEYWORDS: buy SCH58261 | SCH58261 supplier | purchase | cost | manufacturer | order | distributor | buy 160098-96-4 | 160098-96-4 supplier