Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4985 | Purity: >98% |
 | |
| Chemical structure of SC-57461A |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 423169-68-0 |
|---|---|
| Purity | >98% |
| Formula | C20H26ClNO3 |
| Mol Weight | 363.878 |
| CoA | CoA of SC-57461A |
| Smiles: | CN(CCCOC1=CC=C(C=C1)CC2=CC=CC=C2)CCC(=O)O.Cl |
|---|
KEYWORDS: buy SC-57461A | SC-57461A supplier | purchase | cost | manufacturer | order | distributor | buy 423169-68-0 | 423169-68-0 supplier