Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2157 | Purity: >98% |
 | |
| Chemical structure of SC-514 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 354812-17-2 |
|---|---|
| Purity | >98% |
| Formula | C9H8N2OS2 |
| Mol Weight | 224.303 |
| CoA | CoA of SC-514 |
| Smiles: | NC(=O)C1=C(N)C=C(S1)C1=CSC=C1 |
|---|
KEYWORDS: buy SC-514 | SC-514 supplier | purchase | cost | manufacturer | order | distributor | buy 354812-17-2 | 354812-17-2 supplier