Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4975 | Purity: >98% |
 | |
| Chemical structure of SAR405 R enantiomer |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1946010-79-2 |
|---|---|
| Purity | >98% |
| Formula | C19H21ClF3N5O2 |
| Mol Weight | 443.851 |
| CoA | CoA of SAR405 R enantiomer |
| Smiles: | C[C@@H]1COCCN1C2=CC(=O)N3CC[C@@H](N(C3=N2)CC4=CC(=CN=C4)Cl)C(F)(F)F |
|---|
KEYWORDS: buy SAR405 R enantiomer | SAR405 R enantiomer supplier | purchase | cost | manufacturer | order | distributor | buy 1946010-79-2 | 1946010-79-2 supplier