Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17203 | Purity: >98% |
 | |
| Chemical structure of Sar20 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3113316-81-4 |
|---|---|
| Purity | >98% |
| Formula | C60H102N20O21 |
| Mol Weight | 1439.5732 |
| CoA | CoA of Sar20 |
| Smiles: | O=C(O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CN(C(=O)CNC)C)C)C)C)C)C)C)C)C)C)C)C)C)C)C)C)C)C)C |
|---|
KEYWORDS: buy Sar20 | Sar20 supplier | purchase | cost | manufacturer | order | distributor | buy 3113316-81-4 | 3113316-81-4 supplier