Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A565 | Purity: >98% |
 | |
| Chemical structure of SAR191801 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1234708-04-3 |
|---|---|
| Purity | >98% |
| Formula | C22H20N6O3 |
| Mol Weight | 416.4326 |
| CoA | CoA of SAR191801 |
| Smiles: | CC(C)(O)C1=NC(=NO1)C1=CC(CNC(=O)C2=CN=C(N=C2)C2=NC=CC=C2)=CC=C1 |
|---|
KEYWORDS: buy SAR191801 | SAR191801 supplier | purchase | cost | manufacturer | order | distributor | buy 1234708-04-3 | 1234708-04-3 supplier