Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1996 | Purity: 99.38% |
 | |
| Chemical structure of Saquinavir mesylate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 149845-06-7 |
|---|---|
| Purity | 99.38% |
| Formula | C39H54N6O8S |
| Mol Weight | 766.946 |
| CoA | CoA of Saquinavir mesylate |
| Smiles: | CS(O)(=O)=O.[H][C@@]12CCCC[C@]1([H])CN(CC(O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](CC(N)=O)NC(=O)C1=NC3=CC=CC=C3C=C1)[C@@H](C2)C(=O)NC(C)(C)C |
|---|
KEYWORDS: buy Saquinavir mesylate | Saquinavir mesylate supplier | purchase | cost | manufacturer | order | distributor | buy 149845-06-7 | 149845-06-7 supplier