Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1859 | Purity: >98% |
 | |
| Chemical structure of S6K-18 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1265789-88-5 |
|---|---|
| Purity | >98% |
| Formula | C17H18N4O3S |
| Mol Weight | 358.415 |
| CoA | CoA of S6K-18 |
| Smiles: | CC(C)(C)C1=CC(C(O)=O)=C(NC(=O)NC2=CC3=C(NN=C3)C=C2)S1 |
|---|
KEYWORDS: buy S6K-18 | S6K-18 supplier | purchase | cost | manufacturer | order | distributor | buy 1265789-88-5 | 1265789-88-5 supplier