Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16393 | Purity: >98% |
 | |
| Chemical structure of (S)-penipratynolene |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 674785-94-5 |
|---|---|
| Purity | >98% |
| Formula | C12H12O4 |
| Mol Weight | 220.2213 |
| CoA | CoA of (S)-penipratynolene |
| Smiles: | O(C[C@@H](C#C)O)C1=CC=C(C(OC)=O)C=C1 |
|---|
KEYWORDS: buy (S)-penipratynolene | (S)-penipratynolene supplier | purchase | cost | manufacturer | order | distributor | buy 674785-94-5 | 674785-94-5 supplier