Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1702 | Purity: >98% |
 | |
| Chemical structure of (S)-GSK-F1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | F-1 |
|---|---|
| CAS No. | 1384097-27-1 |
| Purity | >98% |
| Formula | C27H18F5N5O4S |
| Mol Weight | 603.52 |
| CoA | CoA of (S)-GSK-F1 |
| Smiles: | COC1=C(C=C(C=N1)C1=CC2=C(C=C1)N=C(N)N(C2=O)C1=CC=CC=C1C(F)(F)F)S(=O)(=O)NC1=C(F)C=C(F)C=C1 |
|---|
KEYWORDS: buy (S)-GSK-F1 | (S)-GSK-F1 supplier | purchase | cost | manufacturer | order | distributor | buy 1384097-27-1 | 1384097-27-1 supplier