Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1354 | Purity: >98% |
 | |
| Chemical structure of S-Equol |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 531-95-3 |
|---|---|
| Purity | >98% |
| Formula | C15H14O3 |
| Mol Weight | 242.2699 |
| CoA | CoA of S-Equol |
| Smiles: | OC1=CC=C(C=C1)[C@H]1COC2=C(C1)C=CC(O)=C2 |
|---|
KEYWORDS: buy S-Equol | S-Equol supplier | purchase | cost | manufacturer | order | distributor | buy 531-95-3 | 531-95-3 supplier