Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2660 | Purity: >98% |
 | |
| Chemical structure of Ruxolitinib phosphate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1092939-17-7 |
|---|---|
| Purity | >98% |
| Formula | C17H21N6O4P |
| Mol Weight | 404.3602 |
| CoA | CoA of Ruxolitinib phosphate |
| Smiles: | OP(O)(O)=O.N#CC[C@H](C1CCCC1)N1C=C(C=N1)C1=C2C=CNC2=NC=N1 |
|---|
KEYWORDS: buy Ruxolitinib phosphate | Ruxolitinib phosphate supplier | purchase | cost | manufacturer | order | distributor | buy 1092939-17-7 | 1092939-17-7 supplier