Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15256 | Purity: >98% |
 | |
| Chemical structure of RS 16566 dihydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1217788-97-0 |
|---|---|
| Purity | >98% |
| Formula | C18H25Cl3N4O |
| Mol Weight | 419.776 |
| CoA | CoA of RS 16566 dihydrochloride |
| Smiles: | CC(C)N1C=NC2=C(C=C(C=C21)Cl)C(=O)N[C@H]3CN4CCC3CC4.Cl.Cl |
|---|
KEYWORDS: buy RS 16566 dihydrochloride | RS 16566 dihydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1217788-97-0 | 1217788-97-0 supplier