Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1010 | Purity: >98% |
 | |
| Chemical structure of RS-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | RS1 |
|---|---|
| CAS No. | 312756-74-4 |
| Purity | >98% |
| Formula | C20H16Br2N2O3S |
| Mol Weight | 524.226 |
| CoA | CoA of RS-1 |
| Smiles: | BrC1=CC=C(NC(=O)C2=CC=C(Br)C(=C2)S(=O)(=O)NCC2=CC=CC=C2)C=C1 |
|---|
KEYWORDS: buy RS-1 | RS-1 supplier | purchase | cost | manufacturer | order | distributor | buy 312756-74-4 | 312756-74-4 supplier